P07101 | TY3H_HUMAN | Tyrosine 3-monooxygenase (TH)
3D structures mapped by conservation among orthologs
[ Domain: "Aromatic aminoacid monoxygenases, catalytic and oligomerization domains" // Biopterin_H ]
download pymol session
[ Domain: pdbs with more than 2 multi-domains ]
download pymol session
[ Alpha Fold Model ] (go)
Known binders annotated in ChEMBL
IC50 table
| molecule_chembl_id | structure | assay_type | relation | values | units | mol_wt | smiles | organism | assay_chembl_id | bao_label |
|---|---|---|---|---|---|---|---|---|---|---|
| CHEMBL225230 | IC50 | = | 300.0 | nM | 295.38 | CCCN1CCc2cccc3c2[C@H]1Cc1ccc(O)c(O)c1-3 | Homo sapiens | CHEMBL944157 | single protein format | |
| CHEMBL479789 | IC50 | = | 720.0 | nM | 307.09 | N[C@@H](Cc1ccc(O)c(I)c1)C(=O)O | Homo sapiens | CHEMBL984790 | single protein format | |
| CHEMBL330274 | IC50 | = | 1000.0 | nM | 295.38 | CCCN1CCc2cccc3c2[C@@H]1Cc1ccc(O)c(O)c1-3 | Homo sapiens | CHEMBL944157 | single protein format |